C10H11N5O3S2 — CID 6470928
methyl 2-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate (PubChem CID 6470928) has the molecular formula C10H11N5O3S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl 2-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6470928 |
| Molecular Formula | C10H11N5O3S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | methyl 2-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)CSc1nnnn1C |
| InChI | InChI=1S/C10H11N5O3S2/c1-15-10(12-13-14-15)20-5-7(16)11-8-6(3-4-19-8)9(17)18-2/h3-4H,5H2,1-2H3,(H,11,16) |
| InChIKey | MYEKGYYEAXKZNA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |