C13H17N5O3S2 — CID 2646789
ethyl 5-ethyl-2-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate (PubChem CID 2646789) has the molecular formula C13H17N5O3S2 and a molecular weight of 355.45 g/mol. Its IUPAC name is ethyl 5-ethyl-2-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2646789 |
| Molecular Formula | C13H17N5O3S2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | ethyl 5-ethyl-2-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)CSc1nnnn1C |
| InChI | InChI=1S/C13H17N5O3S2/c1-4-8-6-9(12(20)21-5-2)11(23-8)14-10(19)7-22-13-15-16-17-18(13)3/h6H,4-5,7H2,1-3H3,(H,14,19) |
| InChIKey | RQTLXNDGGKEULE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |