C12H15N5O3S2 — CID 24569652
ethyl 3-methyl-5-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-2-carboxylate (PubChem CID 24569652) has the molecular formula C12H15N5O3S2 and a molecular weight of 341.42 g/mol. Its IUPAC name is ethyl 3-methyl-5-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 24569652 |
| Molecular Formula | C12H15N5O3S2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | ethyl 3-methyl-5-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CSc2nnnn2C)cc1C |
| InChI | InChI=1S/C12H15N5O3S2/c1-4-20-11(19)10-7(2)5-9(22-10)13-8(18)6-21-12-14-15-16-17(12)3/h5H,4,6H2,1-3H3,(H,13,18) |
| InChIKey | WWIBRMNLTUASDZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |