C14H19NO5S2 — CID 24569681
ethyl 5-[[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]amino]-3-methylthiophene-2-carboxylate (PubChem CID 24569681) has the molecular formula C14H19NO5S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl 5-[[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]amino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]amino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 24569681 |
| Molecular Formula | C14H19NO5S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | ethyl 5-[[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]amino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)CSCC(=O)Nc1cc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C14H19NO5S2/c1-4-19-12(17)8-21-7-10(16)15-11-6-9(3)13(22-11)14(18)20-5-2/h6H,4-5,7-8H2,1-3H3,(H,15,16) |
| InChIKey | TYKYAOFPQGCQOO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |