C10H13NO4S — CID 43623989
ethyl 5-(methoxycarbonylamino)-3-methylthiophene-2-carboxylate (PubChem CID 43623989) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is ethyl 5-(methoxycarbonylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-(methoxycarbonylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 43623989 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | ethyl 5-(methoxycarbonylamino)-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)OC)cc1C |
| InChI | InChI=1S/C10H13NO4S/c1-4-15-9(12)8-6(2)5-7(16-8)11-10(13)14-3/h5H,4H2,1-3H3,(H,11,13) |
| InChIKey | VSTRULJKGSBKLW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |