C13H16N2O3S2 — CID 2373848
ethyl 5-(cyclopropanecarbonylcarbamothioylamino)-3-methylthiophene-2-carboxylate (PubChem CID 2373848) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is ethyl 5-(cyclopropanecarbonylcarbamothioylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-(cyclopropanecarbonylcarbamothioylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 2373848 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | ethyl 5-(cyclopropanecarbonylcarbamothioylamino)-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(=O)C2CC2)cc1C |
| InChI | InChI=1S/C13H16N2O3S2/c1-3-18-12(17)10-7(2)6-9(20-10)14-13(19)15-11(16)8-4-5-8/h6,8H,3-5H2,1-2H3,(H2,14,15,16,19) |
| InChIKey | CCMRBONTVGUDHQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|