C13H21N3O2S2 — CID 8626438
ethyl 5-[2-(dimethylamino)ethylcarbamothioylamino]-3-methylthiophene-2-carboxylate (PubChem CID 8626438) has the molecular formula C13H21N3O2S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is ethyl 5-[2-(dimethylamino)ethylcarbamothioylamino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[2-(dimethylamino)ethylcarbamothioylamino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 8626438 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethyl 5-[2-(dimethylamino)ethylcarbamothioylamino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NCCN(C)C)cc1C |
| InChI | InChI=1S/C13H21N3O2S2/c1-5-18-12(17)11-9(2)8-10(20-11)15-13(19)14-6-7-16(3)4/h8H,5-7H2,1-4H3,(H2,14,15,19) |
| InChIKey | XRJSXNKJXVAOAA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|