C17H20N2O2S2 — CID 2400615
ethyl 5-[(3,4-dimethylphenyl)carbamothioylamino]-3-methylthiophene-2-carboxylate (PubChem CID 2400615) has the molecular formula C17H20N2O2S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is ethyl 5-[(3,4-dimethylphenyl)carbamothioylamino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[(3,4-dimethylphenyl)carbamothioylamino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 2400615 |
| Molecular Formula | C17H20N2O2S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | ethyl 5-[(3,4-dimethylphenyl)carbamothioylamino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)Nc2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C17H20N2O2S2/c1-5-21-16(20)15-12(4)9-14(23-15)19-17(22)18-13-7-6-10(2)11(3)8-13/h6-9H,5H2,1-4H3,(H2,18,19,22) |
| InChIKey | PQMAVWOUIDTJDH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|