C12H18N2O2S2 — CID 8000608
ethyl 3-methyl-5-(propan-2-ylcarbamothioylamino)thiophene-2-carboxylate (PubChem CID 8000608) has the molecular formula C12H18N2O2S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is ethyl 3-methyl-5-(propan-2-ylcarbamothioylamino)thiophene-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-(propan-2-ylcarbamothioylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8000608 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | ethyl 3-methyl-5-(propan-2-ylcarbamothioylamino)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(C)C)cc1C |
| InChI | InChI=1S/C12H18N2O2S2/c1-5-16-11(15)10-8(4)6-9(18-10)14-12(17)13-7(2)3/h6-7H,5H2,1-4H3,(H2,13,14,17) |
| InChIKey | RXTLMHVTKQFGHT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|