C13H15NO3S — CID 47158600
prop-2-enyl 5-(cyclopropanecarbonylamino)-3-methylthiophene-2-carboxylate (PubChem CID 47158600) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is prop-2-enyl 5-(cyclopropanecarbonylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | prop-2-enyl 5-(cyclopropanecarbonylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 47158600 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | prop-2-enyl 5-(cyclopropanecarbonylamino)-3-methylthiophene-2-carboxylate |
| SMILES | C=CCOC(=O)c1sc(NC(=O)C2CC2)cc1C |
| InChI | InChI=1S/C13H15NO3S/c1-3-6-17-13(16)11-8(2)7-10(18-11)14-12(15)9-4-5-9/h3,7,9H,1,4-6H2,2H3,(H,14,15) |
| InChIKey | GIUFXQKBVHDZSM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|