C13H13NO3S2 — CID 43406104
ethyl 3-methyl-5-(thiophene-3-carbonylamino)thiophene-2-carboxylate (PubChem CID 43406104) has the molecular formula C13H13NO3S2 and a molecular weight of 295.38 g/mol. Its IUPAC name is ethyl 3-methyl-5-(thiophene-3-carbonylamino)thiophene-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-(thiophene-3-carbonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43406104 |
| Molecular Formula | C13H13NO3S2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | ethyl 3-methyl-5-(thiophene-3-carbonylamino)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccsc2)cc1C |
| InChI | InChI=1S/C13H13NO3S2/c1-3-17-13(16)11-8(2)6-10(19-11)14-12(15)9-4-5-18-7-9/h4-7H,3H2,1-2H3,(H,14,15) |
| InChIKey | LRZJCDHKTMEWEO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |