C11H9NO3S2 — CID 16771575
3-methyl-5-(thiophene-3-carbonylamino)thiophene-2-carboxylic acid (PubChem CID 16771575) has the molecular formula C11H9NO3S2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-methyl-5-(thiophene-3-carbonylamino)thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-(thiophene-3-carbonylamino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 16771575 |
| Molecular Formula | C11H9NO3S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 3-methyl-5-(thiophene-3-carbonylamino)thiophene-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)c2ccsc2)sc1C(=O)O |
| InChI | InChI=1S/C11H9NO3S2/c1-6-4-8(17-9(6)11(14)15)12-10(13)7-2-3-16-5-7/h2-5H,1H3,(H,12,13)(H,14,15) |
| InChIKey | KIVBMXXMKFARMQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |