C14H13NO5S2 — CID 16770376
3-methyl-5-[(3-methylsulfonylbenzoyl)amino]thiophene-2-carboxylic acid (PubChem CID 16770376) has the molecular formula C14H13NO5S2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-methyl-5-[(3-methylsulfonylbenzoyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(3-methylsulfonylbenzoyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 16770376 |
| Molecular Formula | C14H13NO5S2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 3-methyl-5-[(3-methylsulfonylbenzoyl)amino]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)c2cccc(S(C)(=O)=O)c2)sc1C(=O)O |
| InChI | InChI=1S/C14H13NO5S2/c1-8-6-11(21-12(8)14(17)18)15-13(16)9-4-3-5-10(7-9)22(2,19)20/h3-7H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | CFNHFXFWEJBTNC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |