C15H13N3O7S — CID 55331730
ethyl 5-[(3,5-dinitrobenzoyl)amino]-3-methylthiophene-2-carboxylate (PubChem CID 55331730) has the molecular formula C15H13N3O7S and a molecular weight of 379.35 g/mol. Its IUPAC name is ethyl 5-[(3,5-dinitrobenzoyl)amino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[(3,5-dinitrobenzoyl)amino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 55331730 |
| Molecular Formula | C15H13N3O7S |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | ethyl 5-[(3,5-dinitrobenzoyl)amino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C15H13N3O7S/c1-3-25-15(20)13-8(2)4-12(26-13)16-14(19)9-5-10(17(21)22)7-11(6-9)18(23)24/h4-7H,3H2,1-2H3,(H,16,19) |
| InChIKey | JLHQUKBNTLGIGX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|