C17H16N6O5S2 — CID 2120494
ethyl 3-methyl-5-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]thiophene-2-carboxylate (PubChem CID 2120494) has the molecular formula C17H16N6O5S2 and a molecular weight of 448.49 g/mol. Its IUPAC name is ethyl 3-methyl-5-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2120494 |
| Molecular Formula | C17H16N6O5S2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | ethyl 3-methyl-5-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2cc([N+](=O)[O-])ccc2Sc2nnnn2C)cc1C |
| InChI | InChI=1S/C17H16N6O5S2/c1-4-28-16(25)14-9(2)7-13(30-14)18-15(24)11-8-10(23(26)27)5-6-12(11)29-17-19-20-21-22(17)3/h5-8H,4H2,1-3H3,(H,18,24) |
| InChIKey | PRKDCKPEZBNMDP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|