C20H18N8O3S — CID 170761821
N-[4-(2,5-dimethylpyrazol-3-yl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide (PubChem CID 170761821) has the molecular formula C20H18N8O3S and a molecular weight of 450.48 g/mol. Its IUPAC name is N-[4-(2,5-dimethylpyrazol-3-yl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide.
| Compound Name | N-[4-(2,5-dimethylpyrazol-3-yl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 170761821 |
| Molecular Formula | C20H18N8O3S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[4-(2,5-dimethylpyrazol-3-yl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide |
| SMILES | Cc1cc(-c2ccc(NC(=O)c3cc([N+](=O)[O-])ccc3Sc3nnnn3C)cc2)n(C)n1 |
| InChI | InChI=1S/C20H18N8O3S/c1-12-10-17(26(2)23-12)13-4-6-14(7-5-13)21-19(29)16-11-15(28(30)31)8-9-18(16)32-20-22-24-25-27(20)3/h4-11H,1-3H3,(H,21,29) |
| InChIKey | GNWCKUWNMPLGFL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|