C15H9F4N7O3S2 — CID 170761814
N-[3-fluoro-5-(trifluoromethylsulfanyl)-2-pyridinyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide (PubChem CID 170761814) has the molecular formula C15H9F4N7O3S2 and a molecular weight of 475.41 g/mol. Its IUPAC name is N-[3-fluoro-5-(trifluoromethylsulfanyl)-2-pyridinyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide.
| Compound Name | N-[3-fluoro-5-(trifluoromethylsulfanyl)-2-pyridinyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 170761814 |
| Molecular Formula | C15H9F4N7O3S2 |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | N-[3-fluoro-5-(trifluoromethylsulfanyl)-2-pyridinyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide |
| SMILES | Cn1nnnc1Sc1ccc([N+](=O)[O-])cc1C(=O)Nc1ncc(SC(F)(F)F)cc1F |
| InChI | InChI=1S/C15H9F4N7O3S2/c1-25-14(22-23-24-25)30-11-3-2-7(26(28)29)4-9(11)13(27)21-12-10(16)5-8(6-20-12)31-15(17,18)19/h2-6H,1H3,(H,20,21,27) |
| InChIKey | ZQVDIFKYOXWPAG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|