C21H20FN7O4S — CID 170761002
2-cyclopentyl-4-fluoro-5-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]benzamide (PubChem CID 170761002) has the molecular formula C21H20FN7O4S and a molecular weight of 485.50 g/mol. Its IUPAC name is 2-cyclopentyl-4-fluoro-5-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]benzamide.
| Compound Name | 2-cyclopentyl-4-fluoro-5-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]benzamide |
|---|---|
| PubChem CID | 170761002 |
| Molecular Formula | C21H20FN7O4S |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 2-cyclopentyl-4-fluoro-5-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]benzamide |
| SMILES | Cn1nnnc1Sc1ccc([N+](=O)[O-])cc1C(=O)Nc1cc(C(N)=O)c(C2CCCC2)cc1F |
| InChI | InChI=1S/C21H20FN7O4S/c1-28-21(25-26-27-28)34-18-7-6-12(29(32)33)8-15(18)20(31)24-17-10-14(19(23)30)13(9-16(17)22)11-4-2-3-5-11/h6-11H,2-5H2,1H3,(H2,23,30)(H,24,31) |
| InChIKey | YJUJLVFJEGECLK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 158.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|