C20H21FN8O3S — CID 170760752
2-[1-(2-aminoethyl)tetrazol-5-yl]sulfanyl-N-(5-cyclopentyl-3-fluoro-2-pyridinyl)-5-nitrobenzamide (PubChem CID 170760752) has the molecular formula C20H21FN8O3S and a molecular weight of 472.51 g/mol. Its IUPAC name is 2-[1-(2-aminoethyl)tetrazol-5-yl]sulfanyl-N-(5-cyclopentyl-3-fluoro-2-pyridinyl)-5-nitrobenzamide.
| Compound Name | 2-[1-(2-aminoethyl)tetrazol-5-yl]sulfanyl-N-(5-cyclopentyl-3-fluoro-2-pyridinyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 170760752 |
| Molecular Formula | C20H21FN8O3S |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2-[1-(2-aminoethyl)tetrazol-5-yl]sulfanyl-N-(5-cyclopentyl-3-fluoro-2-pyridinyl)-5-nitrobenzamide |
| SMILES | NCCn1nnnc1Sc1ccc([N+](=O)[O-])cc1C(=O)Nc1ncc(C2CCCC2)cc1F |
| InChI | InChI=1S/C20H21FN8O3S/c21-16-9-13(12-3-1-2-4-12)11-23-18(16)24-19(30)15-10-14(29(31)32)5-6-17(15)33-20-25-26-27-28(20)8-7-22/h5-6,9-12H,1-4,7-8,22H2,(H,23,24,30) |
| InChIKey | GNHQEEZAWLKNGK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 154.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|