C22H19FN6O3S — CID 170761851
N-(2-cyano-4-cyclopentyl-6-fluorophenyl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzamide (PubChem CID 170761851) has the molecular formula C22H19FN6O3S and a molecular weight of 466.50 g/mol. Its IUPAC name is N-(2-cyano-4-cyclopentyl-6-fluorophenyl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzamide.
| Compound Name | N-(2-cyano-4-cyclopentyl-6-fluorophenyl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 170761851 |
| Molecular Formula | C22H19FN6O3S |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-(2-cyano-4-cyclopentyl-6-fluorophenyl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzamide |
| SMILES | Cn1cnnc1Sc1ccc([N+](=O)[O-])cc1C(=O)Nc1c(F)cc(C2CCCC2)cc1C#N |
| InChI | InChI=1S/C22H19FN6O3S/c1-28-12-25-27-22(28)33-19-7-6-16(29(31)32)10-17(19)21(30)26-20-15(11-24)8-14(9-18(20)23)13-4-2-3-5-13/h6-10,12-13H,2-5H2,1H3,(H,26,30) |
| InChIKey | NQAFBAWKXQBBHT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|