C23H24F2N6O3S — CID 170761176
N-(4-cyclopentyl-2,6-difluorophenyl)-2-[[4-[2-(methylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]-5-nitrobenzamide (PubChem CID 170761176) has the molecular formula C23H24F2N6O3S and a molecular weight of 502.55 g/mol. Its IUPAC name is N-(4-cyclopentyl-2,6-difluorophenyl)-2-[[4-[2-(methylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]-5-nitrobenzamide.
| Compound Name | N-(4-cyclopentyl-2,6-difluorophenyl)-2-[[4-[2-(methylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 170761176 |
| Molecular Formula | C23H24F2N6O3S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N-(4-cyclopentyl-2,6-difluorophenyl)-2-[[4-[2-(methylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]-5-nitrobenzamide |
| SMILES | CNCCn1cnnc1Sc1ccc([N+](=O)[O-])cc1C(=O)Nc1c(F)cc(C2CCCC2)cc1F |
| InChI | InChI=1S/C23H24F2N6O3S/c1-26-8-9-30-13-27-29-23(30)35-20-7-6-16(31(33)34)12-17(20)22(32)28-21-18(24)10-15(11-19(21)25)14-4-2-3-5-14/h6-7,10-14,26H,2-5,8-9H2,1H3,(H,28,32) |
| InChIKey | ZDLVCFGGHUXEBF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|