C23H26N6O4S — CID 170760797
N-(4-cyclohexylphenyl)-N-(2-hydroxyethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide (PubChem CID 170760797) has the molecular formula C23H26N6O4S and a molecular weight of 482.57 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-N-(2-hydroxyethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide.
| Compound Name | N-(4-cyclohexylphenyl)-N-(2-hydroxyethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 170760797 |
| Molecular Formula | C23H26N6O4S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-(4-cyclohexylphenyl)-N-(2-hydroxyethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide |
| SMILES | Cn1nnnc1Sc1ccc([N+](=O)[O-])cc1C(=O)N(CCO)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H26N6O4S/c1-27-23(24-25-26-27)34-21-12-11-19(29(32)33)15-20(21)22(31)28(13-14-30)18-9-7-17(8-10-18)16-5-3-2-4-6-16/h7-12,15-16,30H,2-6,13-14H2,1H3 |
| InChIKey | VXPZDAGVSUXLKG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|