C22H24N6O3S — CID 170761395
N-[4-(1-methylcyclohexyl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide (PubChem CID 170761395) has the molecular formula C22H24N6O3S and a molecular weight of 452.54 g/mol. Its IUPAC name is N-[4-(1-methylcyclohexyl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide.
| Compound Name | N-[4-(1-methylcyclohexyl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 170761395 |
| Molecular Formula | C22H24N6O3S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-[4-(1-methylcyclohexyl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide |
| SMILES | Cn1nnnc1Sc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C2(C)CCCCC2)cc1 |
| InChI | InChI=1S/C22H24N6O3S/c1-22(12-4-3-5-13-22)15-6-8-16(9-7-15)23-20(29)18-14-17(28(30)31)10-11-19(18)32-21-24-25-26-27(21)2/h6-11,14H,3-5,12-13H2,1-2H3,(H,23,29) |
| InChIKey | DCBFRDCFIJTQCD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|