C19H18N6O7S — CID 4843599
methyl 4,5-dimethoxy-2-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]benzoate (PubChem CID 4843599) has the molecular formula C19H18N6O7S and a molecular weight of 474.46 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]benzoate.
| Compound Name | methyl 4,5-dimethoxy-2-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 4843599 |
| Molecular Formula | C19H18N6O7S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[[2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)c1cc([N+](=O)[O-])ccc1Sc1nnnn1C |
| InChI | InChI=1S/C19H18N6O7S/c1-24-19(21-22-23-24)33-16-6-5-10(25(28)29)7-12(16)17(26)20-13-9-15(31-3)14(30-2)8-11(13)18(27)32-4/h5-9H,1-4H3,(H,20,26) |
| InChIKey | LVPWODAJZNYQBO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|