C18H14N8O3S — CID 170761844
N-(4-imidazol-1-ylphenyl)-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide (PubChem CID 170761844) has the molecular formula C18H14N8O3S and a molecular weight of 422.43 g/mol. Its IUPAC name is N-(4-imidazol-1-ylphenyl)-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide.
| Compound Name | N-(4-imidazol-1-ylphenyl)-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 170761844 |
| Molecular Formula | C18H14N8O3S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-(4-imidazol-1-ylphenyl)-2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzamide |
| SMILES | Cn1nnnc1Sc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C18H14N8O3S/c1-24-18(21-22-23-24)30-16-7-6-14(26(28)29)10-15(16)17(27)20-12-2-4-13(5-3-12)25-9-8-19-11-25/h2-11H,1H3,(H,20,27) |
| InChIKey | NXJHRTUDJYHPIA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|