C16H18N6O7S2 — CID 4654841
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoate (PubChem CID 4654841) has the molecular formula C16H18N6O7S2 and a molecular weight of 470.49 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoate |
|---|---|
| PubChem CID | 4654841 |
| Molecular Formula | C16H18N6O7S2 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-(1-methyltetrazol-5-yl)sulfanyl-5-nitrobenzoate |
| SMILES | CN(C(=O)COC(=O)c1cc([N+](=O)[O-])ccc1Sc1nnnn1C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18N6O7S2/c1-20(11-5-6-31(27,28)9-11)14(23)8-29-15(24)12-7-10(22(25)26)3-4-13(12)30-16-17-18-19-21(16)2/h3-4,7,11H,5-6,8-9H2,1-2H3 |
| InChIKey | YGAIOYUDBVJWQK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 167.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|