C18H19N3O7S3 — CID 2469578
[2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 2469578) has the molecular formula C18H19N3O7S3 and a molecular weight of 485.57 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 2469578 |
| Molecular Formula | C18H19N3O7S3 |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc(C(=O)OCC(=O)N(C)[C@@H]3CCS(=O)(=O)C3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C18H19N3O7S3/c1-11-9-29-18(19-11)30-15-4-3-12(7-14(15)21(24)25)17(23)28-8-16(22)20(2)13-5-6-31(26,27)10-13/h3-4,7,9,13H,5-6,8,10H2,1-2H3/t13-/m1/s1 |
| InChIKey | PEQMHOXBVNVQON-CYBMUJFWSA-N |
| XLogP | 2.31 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|