C23H27N3O5S2 — CID 98406183
[2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 98406183) has the molecular formula C23H27N3O5S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is [2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 98406183 |
| Molecular Formula | C23H27N3O5S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc(C(=O)OCC(=O)N3C[C@@]4(C)C[C@H]3CC(C)(C)C4)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C23H27N3O5S2/c1-14-11-32-21(24-14)33-18-6-5-15(7-17(18)26(29)30)20(28)31-10-19(27)25-13-23(4)9-16(25)8-22(2,3)12-23/h5-7,11,16H,8-10,12-13H2,1-4H3/t16-,23+/m1/s1 |
| InChIKey | BWSQTQSDIWBBJL-MWTRTKDXSA-N |
| XLogP | 5.09 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|