C21H16N4O6S2 — CID 55325482
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 55325482) has the molecular formula C21H16N4O6S2 and a molecular weight of 484.52 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 55325482 |
| Molecular Formula | C21H16N4O6S2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cc1csc(Sc2ccc(C(=O)OCC(=O)N3CC(=O)Nc4ccccc43)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C21H16N4O6S2/c1-12-11-32-21(22-12)33-17-7-6-13(8-16(17)25(29)30)20(28)31-10-19(27)24-9-18(26)23-14-4-2-3-5-15(14)24/h2-8,11H,9-10H2,1H3,(H,23,26) |
| InChIKey | BLZSSYATPLOGQL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|