C25H21N3O5S2 — CID 2413931
[2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 2413931) has the molecular formula C25H21N3O5S2 and a molecular weight of 507.59 g/mol. Its IUPAC name is [2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 2413931 |
| Molecular Formula | C25H21N3O5S2 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | [2-[ethyl(naphthalen-1-yl)amino]-2-oxoethyl] 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | CCN(C(=O)COC(=O)c1ccc(Sc2nc(C)cs2)c([N+](=O)[O-])c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H21N3O5S2/c1-3-27(20-10-6-8-17-7-4-5-9-19(17)20)23(29)14-33-24(30)18-11-12-22(21(13-18)28(31)32)35-25-26-16(2)15-34-25/h4-13,15H,3,14H2,1-2H3 |
| InChIKey | MXXLUPUCYSENMZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|