C19H24N2O5 — CID 23794454
[2-oxo-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethyl] 2-nitrobenzoate (PubChem CID 23794454) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is [2-oxo-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethyl] 2-nitrobenzoate.
| Compound Name | [2-oxo-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 23794454 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [2-oxo-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethyl] 2-nitrobenzoate |
| SMILES | CC1(C)CC2CC(C)(CN2C(=O)COC(=O)c2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H24N2O5/c1-18(2)8-13-9-19(3,11-18)12-20(13)16(22)10-26-17(23)14-6-4-5-7-15(14)21(24)25/h4-7,13H,8-12H2,1-3H3 |
| InChIKey | MTZBBPLEOVMNES-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|