C22H25NO5 — CID 98285168
[2-oxo-2-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 2-oxochromene-3-carboxylate (PubChem CID 98285168) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is [2-oxo-2-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-oxo-2-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 98285168 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [2-oxo-2-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 2-oxochromene-3-carboxylate |
| SMILES | CC1(C)C[C@H]2C[C@@](C)(CN2C(=O)COC(=O)c2cc3ccccc3oc2=O)C1 |
| InChI | InChI=1S/C22H25NO5/c1-21(2)9-15-10-22(3,12-21)13-23(15)18(24)11-27-19(25)16-8-14-6-4-5-7-17(14)28-20(16)26/h4-8,15H,9-13H2,1-3H3/t15-,22+/m0/s1 |
| InChIKey | OTHSNUSLUNTTQV-OYHNWAKOSA-N |
| XLogP | 3.38 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|