C27H27NO5 — CID 98183493
[2-oxo-2-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 98183493) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is [2-oxo-2-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-oxo-2-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 98183493 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [2-oxo-2-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | CC1(C)C[C@H]2C[C@@](C)(CN2C(=O)COC(=O)c2cccc3c2C(=O)c2ccccc2C3=O)C1 |
| InChI | InChI=1S/C27H27NO5/c1-26(2)11-16-12-27(3,14-26)15-28(16)21(29)13-33-25(32)20-10-6-9-19-22(20)24(31)18-8-5-4-7-17(18)23(19)30/h4-10,16H,11-15H2,1-3H3/t16-,27+/m0/s1 |
| InChIKey | VWAWTUKVRVMZBS-RKOGDMNLSA-N |
| XLogP | 4.05 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|