C22H19NO7S — CID 41144257
[2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 41144257) has the molecular formula C22H19NO7S and a molecular weight of 441.46 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 41144257 |
| Molecular Formula | C22H19NO7S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | CN(C(=O)COC(=O)c1cccc2c1C(=O)c1ccccc1C2=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H19NO7S/c1-23(13-9-10-31(28,29)12-13)18(24)11-30-22(27)17-8-4-7-16-19(17)21(26)15-6-3-2-5-14(15)20(16)25/h2-8,13H,9-12H2,1H3/t13-/m1/s1 |
| InChIKey | RXYYOJJGZOBELN-CYBMUJFWSA-N |
| XLogP | 1.26 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|