C14H16INO5S — CID 3956994
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-iodobenzoate (PubChem CID 3956994) has the molecular formula C14H16INO5S and a molecular weight of 437.26 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-iodobenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-iodobenzoate |
|---|---|
| PubChem CID | 3956994 |
| Molecular Formula | C14H16INO5S |
| Molecular Weight | 437.26 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-iodobenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccc(I)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16INO5S/c1-16(12-6-7-22(19,20)9-12)13(17)8-21-14(18)10-2-4-11(15)5-3-10/h2-5,12H,6-9H2,1H3 |
| InChIKey | LXIJBMKIPWWSBO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|