C19H27NO7S — CID 42970699
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-butoxy-3-methoxybenzoate (PubChem CID 42970699) has the molecular formula C19H27NO7S and a molecular weight of 413.49 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-butoxy-3-methoxybenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-butoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 42970699 |
| Molecular Formula | C19H27NO7S |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 4-butoxy-3-methoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)N(C)C2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C19H27NO7S/c1-4-5-9-26-16-7-6-14(11-17(16)25-3)19(22)27-12-18(21)20(2)15-8-10-28(23,24)13-15/h6-7,11,15H,4-5,8-10,12-13H2,1-3H3 |
| InChIKey | DAIJEYUBYGBJEZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|