C22H21NO5S — CID 7786570
[2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] anthracene-9-carboxylate (PubChem CID 7786570) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] anthracene-9-carboxylate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 7786570 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] anthracene-9-carboxylate |
| SMILES | CN(C(=O)COC(=O)c1c2ccccc2cc2ccccc12)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H21NO5S/c1-23(17-10-11-29(26,27)14-17)20(24)13-28-22(25)21-18-8-4-2-6-15(18)12-16-7-3-5-9-19(16)21/h2-9,12,17H,10-11,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | HFZHXEQMRBTVBL-KRWDZBQOSA-N |
| XLogP | 2.80 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|