C22H25N5O3S2 — CID 170760740
N-(4-cyclohexylphenyl)-5-methylsulfonyl-2-(1-methyltetrazol-5-yl)sulfanylbenzamide (PubChem CID 170760740) has the molecular formula C22H25N5O3S2 and a molecular weight of 471.61 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-5-methylsulfonyl-2-(1-methyltetrazol-5-yl)sulfanylbenzamide.
| Compound Name | N-(4-cyclohexylphenyl)-5-methylsulfonyl-2-(1-methyltetrazol-5-yl)sulfanylbenzamide |
|---|---|
| PubChem CID | 170760740 |
| Molecular Formula | C22H25N5O3S2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-(4-cyclohexylphenyl)-5-methylsulfonyl-2-(1-methyltetrazol-5-yl)sulfanylbenzamide |
| SMILES | Cn1nnnc1Sc1ccc(S(C)(=O)=O)cc1C(=O)Nc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H25N5O3S2/c1-27-22(24-25-26-27)31-20-13-12-18(32(2,29)30)14-19(20)21(28)23-17-10-8-16(9-11-17)15-6-4-3-5-7-15/h8-15H,3-7H2,1-2H3,(H,23,28) |
| InChIKey | RGIRAXVJPGEIJI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |