C21H21N5O4S — CID 170760917
N-(3-hydroxy-1,1-dimethyl-2,3-dihydroinden-5-yl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzamide (PubChem CID 170760917) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is N-(3-hydroxy-1,1-dimethyl-2,3-dihydroinden-5-yl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzamide.
| Compound Name | N-(3-hydroxy-1,1-dimethyl-2,3-dihydroinden-5-yl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 170760917 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-(3-hydroxy-1,1-dimethyl-2,3-dihydroinden-5-yl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitrobenzamide |
| SMILES | Cn1cnnc1Sc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc2c(c1)C(O)CC2(C)C |
| InChI | InChI=1S/C21H21N5O4S/c1-21(2)10-17(27)14-8-12(4-6-16(14)21)23-19(28)15-9-13(26(29)30)5-7-18(15)31-20-24-22-11-25(20)3/h4-9,11,17,27H,10H2,1-3H3,(H,23,28) |
| InChIKey | YPAHAEUHYWHVSY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|