C18H15F2N5O3S — CID 112763866
N-[1-(2,4-difluorophenyl)ethyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 112763866) has the molecular formula C18H15F2N5O3S and a molecular weight of 419.41 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 112763866 |
| Molecular Formula | C18H15F2N5O3S |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | CC(NC(=O)c1ccc(Sc2nncn2C)c([N+](=O)[O-])c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H15F2N5O3S/c1-10(13-5-4-12(19)8-14(13)20)22-17(26)11-3-6-16(15(7-11)25(27)28)29-18-23-21-9-24(18)2/h3-10H,1-2H3,(H,22,26) |
| InChIKey | CAUVOQDCQAKTEZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|