C12H14N6O3S — CID 119382432
N-(2-aminoethyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 119382432) has the molecular formula C12H14N6O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-(2-aminoethyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 119382432 |
| Molecular Formula | C12H14N6O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-(2-aminoethyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)NCCN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N6O3S/c1-17-7-15-16-12(17)22-10-3-2-8(6-9(10)18(20)21)11(19)14-5-4-13/h2-3,6-7H,4-5,13H2,1H3,(H,14,19) |
| InChIKey | HXPLTHRDWTXYMX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|