C17H22N6O4S — CID 55614103
4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-morpholin-4-ylpropyl)-3-nitrobenzamide (PubChem CID 55614103) has the molecular formula C17H22N6O4S and a molecular weight of 406.47 g/mol. Its IUPAC name is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-morpholin-4-ylpropyl)-3-nitrobenzamide.
| Compound Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-morpholin-4-ylpropyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 55614103 |
| Molecular Formula | C17H22N6O4S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-morpholin-4-ylpropyl)-3-nitrobenzamide |
| SMILES | CC(CNC(=O)c1ccc(Sc2nncn2C)c([N+](=O)[O-])c1)N1CCOCC1 |
| InChI | InChI=1S/C17H22N6O4S/c1-12(22-5-7-27-8-6-22)10-18-16(24)13-3-4-15(14(9-13)23(25)26)28-17-20-19-11-21(17)2/h3-4,9,11-12H,5-8,10H2,1-2H3,(H,18,24) |
| InChIKey | UCHNRNWKQJPNNK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|