C16H23ClN6O3S — CID 119569070
N-[3-(aminomethyl)pentan-3-yl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide;hydrochloride (PubChem CID 119569070) has the molecular formula C16H23ClN6O3S and a molecular weight of 414.92 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119569070 |
| Molecular Formula | C16H23ClN6O3S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)c1ccc(Sc2nncn2C)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C16H22N6O3S.ClH/c1-4-16(5-2,9-17)19-14(23)11-6-7-13(12(8-11)22(24)25)26-15-20-18-10-21(15)3;/h6-8,10H,4-5,9,17H2,1-3H3,(H,19,23);1H |
| InChIKey | MMHFOWUXHOINMF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|