C19H18N6O6S — CID 4033776
N'-(3,5-dimethoxybenzoyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzohydrazide (PubChem CID 4033776) has the molecular formula C19H18N6O6S and a molecular weight of 458.46 g/mol. Its IUPAC name is N'-(3,5-dimethoxybenzoyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzohydrazide.
| Compound Name | N'-(3,5-dimethoxybenzoyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 4033776 |
| Molecular Formula | C19H18N6O6S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | N'-(3,5-dimethoxybenzoyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzohydrazide |
| SMILES | COc1cc(OC)cc(C(=O)NNC(=O)c2ccc(Sc3nncn3C)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H18N6O6S/c1-24-10-20-23-19(24)32-16-5-4-11(8-15(16)25(28)29)17(26)21-22-18(27)12-6-13(30-2)9-14(7-12)31-3/h4-10H,1-3H3,(H,21,26)(H,22,27) |
| InChIKey | ROCXZCYWTJRGFK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 150.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|