C14H12N6O3S2 — CID 26362821
N-(4-methyl-1,3-thiazol-2-yl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 26362821) has the molecular formula C14H12N6O3S2 and a molecular weight of 376.42 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 26362821 |
| Molecular Formula | C14H12N6O3S2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | Cc1csc(NC(=O)c2ccc(Sc3nncn3C)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H12N6O3S2/c1-8-6-24-13(16-8)17-12(21)9-3-4-11(10(5-9)20(22)23)25-14-18-15-7-19(14)2/h3-7H,1-2H3,(H,16,17,21) |
| InChIKey | QRVPEDAAQVHOGA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|