C22H20N6O3S2 — CID 24657612
4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 24657612) has the molecular formula C22H20N6O3S2 and a molecular weight of 480.58 g/mol. Its IUPAC name is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 24657612 |
| Molecular Formula | C22H20N6O3S2 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(C)c1ccc(-c2csc(NC(=O)c3ccc(Sc4nncn4C)c([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C22H20N6O3S2/c1-13(2)14-4-6-15(7-5-14)17-11-32-21(24-17)25-20(29)16-8-9-19(18(10-16)28(30)31)33-22-26-23-12-27(22)3/h4-13H,1-3H3,(H,24,25,29) |
| InChIKey | OXPOLGJIUSNYLE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|