C21H18N6O5S2 — CID 2080528
N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 2080528) has the molecular formula C21H18N6O5S2 and a molecular weight of 498.55 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 2080528 |
| Molecular Formula | C21H18N6O5S2 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | COc1ccc(-c2csc(NC(=O)c3ccc(Sc4nncn4C)c([N+](=O)[O-])c3)n2)cc1OC |
| InChI | InChI=1S/C21H18N6O5S2/c1-26-11-22-25-21(26)34-18-7-5-13(8-15(18)27(29)30)19(28)24-20-23-14(10-33-20)12-4-6-16(31-2)17(9-12)32-3/h4-11H,1-3H3,(H,23,24,28) |
| InChIKey | NFEJOJXXHHUNIM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|