C21H15ClN6O5S2 — CID 23768405
[2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 23768405) has the molecular formula C21H15ClN6O5S2 and a molecular weight of 530.98 g/mol. Its IUPAC name is [2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 23768405 |
| Molecular Formula | C21H15ClN6O5S2 |
| Molecular Weight | 530.98 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | [2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)OCC(=O)Nc2nc(-c3ccccc3Cl)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H15ClN6O5S2/c1-27-11-23-26-21(27)35-17-7-6-12(8-16(17)28(31)32)19(30)33-9-18(29)25-20-24-15(10-34-20)13-4-2-3-5-14(13)22/h2-8,10-11H,9H2,1H3,(H,24,25,29) |
| InChIKey | AKTZJZFALQLMHV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.98 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|