C13H12N6O6S — CID 2604091
[2-(carbamoylamino)-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 2604091) has the molecular formula C13H12N6O6S and a molecular weight of 380.34 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 2604091 |
| Molecular Formula | C13H12N6O6S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)OCC(=O)NC(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N6O6S/c1-18-6-15-17-13(18)26-9-3-2-7(4-8(9)19(23)24)11(21)25-5-10(20)16-12(14)22/h2-4,6H,5H2,1H3,(H3,14,16,20,22) |
| InChIKey | MGACBHDAIKNSFP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 172.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|