C18H13F2N5O5S — CID 2604178
[2-(3,4-difluoroanilino)-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 2604178) has the molecular formula C18H13F2N5O5S and a molecular weight of 449.40 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 2604178 |
| Molecular Formula | C18H13F2N5O5S |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)OCC(=O)Nc2ccc(F)c(F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13F2N5O5S/c1-24-9-21-23-18(24)31-15-5-2-10(6-14(15)25(28)29)17(27)30-8-16(26)22-11-3-4-12(19)13(20)7-11/h2-7,9H,8H2,1H3,(H,22,26) |
| InChIKey | SUXORGPLFLNJIY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|